About 3-(1-hydroxybutyl)-2,3-dimethylisoindol-1-one
3-(1-hydroxybutyl)-2,3-dimethylisoindol-1-one (PubChem CID 11139029) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is 3-(1-hydroxybutyl)-2,3-dimethylisoindol-1-one.
Molecular Properties
| Compound Name | 3-(1-hydroxybutyl)-2,3-dimethylisoindol-1-one |
| PubChem CID | 11139029 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 3-(1-hydroxybutyl)-2,3-dimethylisoindol-1-one |
| SMILES | CCCC(O)C1(C)c2ccccc2C(=O)N1C |
| InChI | InChI=1S/C14H19NO2/c1-4-7-12(16)14(2)11-9-6-5-8-10(11)13(17)15(14)3/h5-6,8-9,12,16H,4,7H2,1-3H3 |
| InChIKey | HWDPPCKKAKUKJR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(1-hydroxybutyl)-2,3-dimethylisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-hydroxybutyl)-2,3-dimethylisoindol-1-one?
The IUPAC name of 3-(1-hydroxybutyl)-2,3-dimethylisoindol-1-one (CID 11139029) is 3-(1-hydroxybutyl)-2,3-dimethylisoindol-1-one.
What is the SMILES notation for 3-(1-hydroxybutyl)-2,3-dimethylisoindol-1-one?
The canonical SMILES for 3-(1-hydroxybutyl)-2,3-dimethylisoindol-1-one is CCCC(O)C1(C)c2ccccc2C(=O)N1C.
What is the InChIKey of 3-(1-hydroxybutyl)-2,3-dimethylisoindol-1-one?
The InChIKey is HWDPPCKKAKUKJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c1-4-7-12(16)14(2)11-9-6-5-8-10(11)13(17)15(14)3/h5-6,8-9,12,16H,4,7H2,1-3H3.
What are the key properties of 3-(1-hydroxybutyl)-2,3-dimethylisoindol-1-one?
3-(1-hydroxybutyl)-2,3-dimethylisoindol-1-one has a molecular weight of 233.31 g/mol, XLogP of 2.15, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-hydroxybutyl)-2,3-dimethylisoindol-1-one is sourced from PubChem (CID 11139029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).