About 3-benzylnaphthalen-1-ol
3-benzylnaphthalen-1-ol (PubChem CID 11139055) has the molecular formula C17H14O
and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-benzylnaphthalen-1-ol.
Molecular Properties
| Compound Name | 3-benzylnaphthalen-1-ol |
| PubChem CID | 11139055 |
| Molecular Formula | C17H14O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 3-benzylnaphthalen-1-ol |
| SMILES | Oc1cc(Cc2ccccc2)cc2ccccc12 |
| InChI | InChI=1S/C17H14O/c18-17-12-14(10-13-6-2-1-3-7-13)11-15-8-4-5-9-16(15)17/h1-9,11-12,18H,10H2 |
| InChIKey | FSIJBIUONPSYQC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-benzylnaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylnaphthalen-1-ol?
The IUPAC name of 3-benzylnaphthalen-1-ol (CID 11139055) is 3-benzylnaphthalen-1-ol.
What is the SMILES notation for 3-benzylnaphthalen-1-ol?
The canonical SMILES for 3-benzylnaphthalen-1-ol is Oc1cc(Cc2ccccc2)cc2ccccc12.
What is the InChIKey of 3-benzylnaphthalen-1-ol?
The InChIKey is FSIJBIUONPSYQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O/c18-17-12-14(10-13-6-2-1-3-7-13)11-15-8-4-5-9-16(15)17/h1-9,11-12,18H,10H2.
What are the key properties of 3-benzylnaphthalen-1-ol?
3-benzylnaphthalen-1-ol has a molecular weight of 234.30 g/mol, XLogP of 4.14, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylnaphthalen-1-ol is sourced from PubChem (CID 11139055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).