C15H13NO2 — CID 11139204
methyl (2E,4E)-5-quinolin-2-ylpenta-2,4-dienoate (PubChem CID 11139204) has the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. Its IUPAC name is methyl (2E,4E)-5-quinolin-2-ylpenta-2,4-dienoate.
| Compound Name | methyl (2E,4E)-5-quinolin-2-ylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 11139204 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | methyl (2E,4E)-5-quinolin-2-ylpenta-2,4-dienoate |
| SMILES | COC(=O)/C=C/C=C/c1ccc2ccccc2n1 |
| InChI | InChI=1S/C15H13NO2/c1-18-15(17)9-5-3-7-13-11-10-12-6-2-4-8-14(12)16-13/h2-11H,1H3/b7-3+,9-5+ |
| InChIKey | HJHCEVASZGMWSN-DLYLGUBQSA-N |
| XLogP | 2.98 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|