C14H30N4O3S — CID 111392351
1-[3-(cyclopropylmethoxy)propyl]-3-[3-(ethylsulfonylamino)propyl]-2-methylguanidine (PubChem CID 111392351) has the molecular formula C14H30N4O3S and a molecular weight of 334.49 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)propyl]-3-[3-(ethylsulfonylamino)propyl]-2-methylguanidine.
| Compound Name | 1-[3-(cyclopropylmethoxy)propyl]-3-[3-(ethylsulfonylamino)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111392351 |
| Molecular Formula | C14H30N4O3S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)propyl]-3-[3-(ethylsulfonylamino)propyl]-2-methylguanidine |
| SMILES | CCS(=O)(=O)NCCCN/C(=N\C)NCCCOCC1CC1 |
| InChI | InChI=1S/C14H30N4O3S/c1-3-22(19,20)18-10-4-8-16-14(15-2)17-9-5-11-21-12-13-6-7-13/h13,18H,3-12H2,1-2H3,(H2,15,16,17) |
| InChIKey | AQZXKZBTQSTGMH-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|