C19H31FIN3O — CID 111393000
1-[3-(cyclopropylmethoxy)propyl]-3-[2-(2-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide (PubChem CID 111393000) has the molecular formula C19H31FIN3O and a molecular weight of 463.38 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)propyl]-3-[2-(2-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(cyclopropylmethoxy)propyl]-3-[2-(2-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111393000 |
| Molecular Formula | C19H31FIN3O |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)propyl]-3-[2-(2-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CC1)NCC(C)(C)c1ccccc1F.I |
| InChI | InChI=1S/C19H30FN3O.HI/c1-19(2,16-7-4-5-8-17(16)20)14-23-18(21-3)22-11-6-12-24-13-15-9-10-15;/h4-5,7-8,15H,6,9-14H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | CXSMYMNVFJPSRD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|