C17H25FIN5 — CID 111396166
1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111396166) has the molecular formula C17H25FIN5 and a molecular weight of 445.32 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111396166 |
| Molecular Formula | C17H25FIN5 |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-(2-methyl-3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1cccc(F)c1)NCC(C)Cn1cccn1.I |
| InChI | InChI=1S/C17H24FN5.HI/c1-14(13-23-10-4-8-22-23)12-21-17(19-2)20-9-7-15-5-3-6-16(18)11-15;/h3-6,8,10-11,14H,7,9,12-13H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | ZWQBGSNDJQFEMD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|