C21H25FN4O — CID 111396263
1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine (PubChem CID 111396263) has the molecular formula C21H25FN4O and a molecular weight of 368.46 g/mol. Its IUPAC name is 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111396263 |
| Molecular Formula | C21H25FN4O |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1cccc(F)c1)NCC(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C21H25FN4O/c1-23-21(24-11-9-16-5-4-8-19(22)13-16)25-14-20(27)26-12-10-17-6-2-3-7-18(17)15-26/h2-8,13H,9-12,14-15H2,1H3,(H2,23,24,25) |
| InChIKey | NXMYHVFCMWNGQP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|