C19H30FN3O2 — CID 111396415
ethyl 7-[[N-[2-(3-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]heptanoate (PubChem CID 111396415) has the molecular formula C19H30FN3O2 and a molecular weight of 351.47 g/mol. Its IUPAC name is ethyl 7-[[N-[2-(3-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]heptanoate.
| Compound Name | ethyl 7-[[N-[2-(3-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]heptanoate |
|---|---|
| PubChem CID | 111396415 |
| Molecular Formula | C19H30FN3O2 |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | ethyl 7-[[N-[2-(3-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]heptanoate |
| SMILES | CCOC(=O)CCCCCCN/C(=N\C)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C19H30FN3O2/c1-3-25-18(24)11-6-4-5-7-13-22-19(21-2)23-14-12-16-9-8-10-17(20)15-16/h8-10,15H,3-7,11-14H2,1-2H3,(H2,21,22,23) |
| InChIKey | SULAJVHJOBZKBJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|