C19H39IN4O3 — CID 111396820
tert-butyl N-[3-[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111396820) has the molecular formula C19H39IN4O3 and a molecular weight of 498.45 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111396820 |
| Molecular Formula | C19H39IN4O3 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | tert-butyl N-[3-[[N-(3-cyclohexyloxypropyl)-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCCCOC1CCCCC1.I |
| InChI | InChI=1S/C19H38N4O3.HI/c1-19(2,3)26-18(24)23-13-8-12-21-17(20-4)22-14-9-15-25-16-10-6-5-7-11-16;/h16H,5-15H2,1-4H3,(H,23,24)(H2,20,21,22);1H |
| InChIKey | HETRQHVJVYHZJD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|