C14H22O4 — CID 11139683
methyl (4R,5S,6S)-4-ethenyl-2,2,5-trimethyl-6-prop-1-en-2-yl-1,3-dioxane-5-carboxylate (PubChem CID 11139683) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is methyl (4R,5S,6S)-4-ethenyl-2,2,5-trimethyl-6-prop-1-en-2-yl-1,3-dioxane-5-carboxylate.
| Compound Name | methyl (4R,5S,6S)-4-ethenyl-2,2,5-trimethyl-6-prop-1-en-2-yl-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 11139683 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | methyl (4R,5S,6S)-4-ethenyl-2,2,5-trimethyl-6-prop-1-en-2-yl-1,3-dioxane-5-carboxylate |
| SMILES | C=C[C@H]1OC(C)(C)O[C@@H](C(=C)C)[C@@]1(C)C(=O)OC |
| InChI | InChI=1S/C14H22O4/c1-8-10-14(6,12(15)16-7)11(9(2)3)18-13(4,5)17-10/h8,10-11H,1-2H2,3-7H3/t10-,11+,14+/m1/s1 |
| InChIKey | GBERZOXAKODLDW-SUNKGSAMSA-N |
| XLogP | 2.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|