C15H26O3 — CID 11139693
(1aS,4S,4aS,7S,7bS)-4,7-dimethyl-1a-propan-2-yl-3,4,4a,5,6,7b-hexahydro-2H-azuleno[7,8-b]oxirene-7,7a-diol (PubChem CID 11139693) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1aS,4S,4aS,7S,7bS)-4,7-dimethyl-1a-propan-2-yl-3,4,4a,5,6,7b-hexahydro-2H-azuleno[7,8-b]oxirene-7,7a-diol.
| Compound Name | (1aS,4S,4aS,7S,7bS)-4,7-dimethyl-1a-propan-2-yl-3,4,4a,5,6,7b-hexahydro-2H-azuleno[7,8-b]oxirene-7,7a-diol |
|---|---|
| PubChem CID | 11139693 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1aS,4S,4aS,7S,7bS)-4,7-dimethyl-1a-propan-2-yl-3,4,4a,5,6,7b-hexahydro-2H-azuleno[7,8-b]oxirene-7,7a-diol |
| SMILES | CC(C)[C@@]12CC[C@H](C)[C@@H]3CC[C@](C)(O)C3(O)[C@@H]1O2 |
| InChI | InChI=1S/C15H26O3/c1-9(2)14-8-5-10(3)11-6-7-13(4,16)15(11,17)12(14)18-14/h9-12,16-17H,5-8H2,1-4H3/t10-,11-,12+,13-,14-,15?/m0/s1 |
| InChIKey | RVUOKEAXBYPMTK-CBVGONHWSA-N |
| XLogP | 2.10 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|