About 1-cyclohexyl-3-(2,4,4-trimethylpentan-2-yl)urea
1-cyclohexyl-3-(2,4,4-trimethylpentan-2-yl)urea (PubChem CID 11139699) has the molecular formula C15H30N2O
and a molecular weight of 254.42 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2,4,4-trimethylpentan-2-yl)urea.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-(2,4,4-trimethylpentan-2-yl)urea |
| PubChem CID | 11139699 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 1-cyclohexyl-3-(2,4,4-trimethylpentan-2-yl)urea |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C15H30N2O/c1-14(2,3)11-15(4,5)17-13(18)16-12-9-7-6-8-10-12/h12H,6-11H2,1-5H3,(H2,16,17,18) |
| InChIKey | MKFMYJMFICNOOV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexyl-3-(2,4,4-trimethylpentan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-(2,4,4-trimethylpentan-2-yl)urea?
The IUPAC name of 1-cyclohexyl-3-(2,4,4-trimethylpentan-2-yl)urea (CID 11139699) is 1-cyclohexyl-3-(2,4,4-trimethylpentan-2-yl)urea.
What is the SMILES notation for 1-cyclohexyl-3-(2,4,4-trimethylpentan-2-yl)urea?
The canonical SMILES for 1-cyclohexyl-3-(2,4,4-trimethylpentan-2-yl)urea is CC(C)(C)CC(C)(C)NC(=O)NC1CCCCC1.
What is the InChIKey of 1-cyclohexyl-3-(2,4,4-trimethylpentan-2-yl)urea?
The InChIKey is MKFMYJMFICNOOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O/c1-14(2,3)11-15(4,5)17-13(18)16-12-9-7-6-8-10-12/h12H,6-11H2,1-5H3,(H2,16,17,18).
What are the key properties of 1-cyclohexyl-3-(2,4,4-trimethylpentan-2-yl)urea?
1-cyclohexyl-3-(2,4,4-trimethylpentan-2-yl)urea has a molecular weight of 254.42 g/mol, XLogP of 3.83, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-(2,4,4-trimethylpentan-2-yl)urea is sourced from PubChem (CID 11139699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).