C19H34N4OS — CID 111397416
2-(3-cyclohexyloxypropyl)-1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 111397416) has the molecular formula C19H34N4OS and a molecular weight of 366.58 g/mol. Its IUPAC name is 2-(3-cyclohexyloxypropyl)-1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 2-(3-cyclohexyloxypropyl)-1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111397416 |
| Molecular Formula | C19H34N4OS |
| Molecular Weight | 366.58 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 2-(3-cyclohexyloxypropyl)-1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCCOC1CCCCC1)NCCc1csc(CC)n1 |
| InChI | InChI=1S/C19H34N4OS/c1-3-18-23-16(15-25-18)11-13-22-19(20-4-2)21-12-8-14-24-17-9-6-5-7-10-17/h15,17H,3-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | GJFAROHMDFVISZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|