C16H18O3 — CID 11139782
(4aS,9aR)-spiro[1,2,3,4a,9a,10-hexahydroanthracene-4,2'-1,3-dioxolane]-9-one (PubChem CID 11139782) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is (4aS,9aR)-spiro[1,2,3,4a,9a,10-hexahydroanthracene-4,2'-1,3-dioxolane]-9-one.
| Compound Name | (4aS,9aR)-spiro[1,2,3,4a,9a,10-hexahydroanthracene-4,2'-1,3-dioxolane]-9-one |
|---|---|
| PubChem CID | 11139782 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (4aS,9aR)-spiro[1,2,3,4a,9a,10-hexahydroanthracene-4,2'-1,3-dioxolane]-9-one |
| SMILES | O=C1c2ccccc2C[C@H]2[C@H]1CCCC21OCCO1 |
| InChI | InChI=1S/C16H18O3/c17-15-12-5-2-1-4-11(12)10-14-13(15)6-3-7-16(14)18-8-9-19-16/h1-2,4-5,13-14H,3,6-10H2/t13-,14+/m1/s1 |
| InChIKey | ZCZTZNUPBNTQSA-KGLIPLIRSA-N |
| XLogP | 2.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |