C23H40IN5O2 — CID 111397898
1-(3-cyclohexyloxypropyl)-3-ethyl-2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111397898) has the molecular formula C23H40IN5O2 and a molecular weight of 545.51 g/mol. Its IUPAC name is 1-(3-cyclohexyloxypropyl)-3-ethyl-2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-cyclohexyloxypropyl)-3-ethyl-2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111397898 |
| Molecular Formula | C23H40IN5O2 |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | 1-(3-cyclohexyloxypropyl)-3-ethyl-2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCOC(C)C2)nc1)NCCCOC1CCCCC1.I |
| InChI | InChI=1S/C23H39N5O2.HI/c1-3-24-23(25-12-7-14-30-21-8-5-4-6-9-21)27-17-20-10-11-22(26-16-20)28-13-15-29-19(2)18-28;/h10-11,16,19,21H,3-9,12-15,17-18H2,1-2H3,(H2,24,25,27);1H |
| InChIKey | YETRWPHLRKPEBQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|