C21H39N5O2 — CID 111398995
1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]guanidine (PubChem CID 111398995) has the molecular formula C21H39N5O2 and a molecular weight of 393.58 g/mol. Its IUPAC name is 1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]guanidine |
|---|---|
| PubChem CID | 111398995 |
| Molecular Formula | C21H39N5O2 |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.31 |
| IUPAC Name | 1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]guanidine |
| SMILES | CCN/C(=N\CC(C(C)C)N1CCN(C)CC1)NCCCOCc1ccco1 |
| InChI | InChI=1S/C21H39N5O2/c1-5-22-21(23-9-7-14-27-17-19-8-6-15-28-19)24-16-20(18(2)3)26-12-10-25(4)11-13-26/h6,8,15,18,20H,5,7,9-14,16-17H2,1-4H3,(H2,22,23,24) |
| InChIKey | OKANJLRQQNCWBV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 65.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|