About N-phenyl-2,2-bis(trimethylsilyl)ethenimine
N-phenyl-2,2-bis(trimethylsilyl)ethenimine (PubChem CID 11139902) has the molecular formula C14H23NSi2
and a molecular weight of 261.52 g/mol. Its IUPAC name is N-phenyl-2,2-bis(trimethylsilyl)ethenimine.
Molecular Properties
| Compound Name | N-phenyl-2,2-bis(trimethylsilyl)ethenimine |
| PubChem CID | 11139902 |
| Molecular Formula | C14H23NSi2 |
| Molecular Weight | 261.52 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | N-phenyl-2,2-bis(trimethylsilyl)ethenimine |
| SMILES | C[Si](C)(C)C(=C=Nc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C14H23NSi2/c1-16(2,3)14(17(4,5)6)12-15-13-10-8-7-9-11-13/h7-11H,1-6H3 |
| InChIKey | WJOYCHVQIFGWLM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-phenyl-2,2-bis(trimethylsilyl)ethenimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-2,2-bis(trimethylsilyl)ethenimine?
The IUPAC name of N-phenyl-2,2-bis(trimethylsilyl)ethenimine (CID 11139902) is N-phenyl-2,2-bis(trimethylsilyl)ethenimine.
What is the SMILES notation for N-phenyl-2,2-bis(trimethylsilyl)ethenimine?
The canonical SMILES for N-phenyl-2,2-bis(trimethylsilyl)ethenimine is C[Si](C)(C)C(=C=Nc1ccccc1)[Si](C)(C)C.
What is the InChIKey of N-phenyl-2,2-bis(trimethylsilyl)ethenimine?
The InChIKey is WJOYCHVQIFGWLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NSi2/c1-16(2,3)14(17(4,5)6)12-15-13-10-8-7-9-11-13/h7-11H,1-6H3.
What are the key properties of N-phenyl-2,2-bis(trimethylsilyl)ethenimine?
N-phenyl-2,2-bis(trimethylsilyl)ethenimine has a molecular weight of 261.52 g/mol, XLogP of 4.67, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-2,2-bis(trimethylsilyl)ethenimine is sourced from PubChem (CID 11139902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).