About (2,5-dioxopyrrolidin-1-yl) (4-methylphenyl)methyl carbonate
(2,5-dioxopyrrolidin-1-yl) (4-methylphenyl)methyl carbonate (PubChem CID 11139951) has the molecular formula C13H13NO5
and a molecular weight of 263.25 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (4-methylphenyl)methyl carbonate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (4-methylphenyl)methyl carbonate |
| PubChem CID | 11139951 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (4-methylphenyl)methyl carbonate |
| SMILES | Cc1ccc(COC(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C13H13NO5/c1-9-2-4-10(5-3-9)8-18-13(17)19-14-11(15)6-7-12(14)16/h2-5H,6-8H2,1H3 |
| InChIKey | XRRVAYOGHYNCBD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) (4-methylphenyl)methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) (4-methylphenyl)methyl carbonate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) (4-methylphenyl)methyl carbonate (CID 11139951) is (2,5-dioxopyrrolidin-1-yl) (4-methylphenyl)methyl carbonate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) (4-methylphenyl)methyl carbonate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) (4-methylphenyl)methyl carbonate is Cc1ccc(COC(=O)ON2C(=O)CCC2=O)cc1.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) (4-methylphenyl)methyl carbonate?
The InChIKey is XRRVAYOGHYNCBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO5/c1-9-2-4-10(5-3-9)8-18-13(17)19-14-11(15)6-7-12(14)16/h2-5H,6-8H2,1H3.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) (4-methylphenyl)methyl carbonate?
(2,5-dioxopyrrolidin-1-yl) (4-methylphenyl)methyl carbonate has a molecular weight of 263.25 g/mol, XLogP of 1.71, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) (4-methylphenyl)methyl carbonate is sourced from PubChem (CID 11139951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).