C20H34N4O4 — CID 111399761
1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]guanidine (PubChem CID 111399761) has the molecular formula C20H34N4O4 and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]guanidine.
| Compound Name | 1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111399761 |
| Molecular Formula | C20H34N4O4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 1-[3-(furan-2-ylmethoxy)propyl]-2-methyl-3-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCCOCc1ccco1)NCC(C1CCOC1)N1CCOCC1 |
| InChI | InChI=1S/C20H34N4O4/c1-21-20(22-6-3-9-26-16-18-4-2-10-28-18)23-14-19(17-5-11-27-15-17)24-7-12-25-13-8-24/h2,4,10,17,19H,3,5-9,11-16H2,1H3,(H2,21,22,23) |
| InChIKey | MPPKTENYEAYJNH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|