C16H16N4 — CID 11139995
4-methyl-6-phenyl-2,5,6-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,7-tetraen-8-amine (PubChem CID 11139995) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-methyl-6-phenyl-2,5,6-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,7-tetraen-8-amine.
| Compound Name | 4-methyl-6-phenyl-2,5,6-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,7-tetraen-8-amine |
|---|---|
| PubChem CID | 11139995 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 4-methyl-6-phenyl-2,5,6-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,7-tetraen-8-amine |
| SMILES | Cc1nn(-c2ccccc2)c2c(N)c3c(nc12)CCC3 |
| InChI | InChI=1S/C16H16N4/c1-10-15-16(14(17)12-8-5-9-13(12)18-15)20(19-10)11-6-3-2-4-7-11/h2-4,6-7H,5,8-9H2,1H3,(H2,17,18) |
| InChIKey | WWBPCPFCRPQVPL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |