C17H18F6N6O — CID 1114001
N-benzyl-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-piperazin-1-yl-1,3,5-triazin-2-amine (PubChem CID 1114001) has the molecular formula C17H18F6N6O and a molecular weight of 436.36 g/mol. Its IUPAC name is N-benzyl-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-piperazin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-benzyl-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-piperazin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 1114001 |
| Molecular Formula | C17H18F6N6O |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-benzyl-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-piperazin-1-yl-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)C(Oc1nc(NCc2ccccc2)nc(N2CCNCC2)n1)C(F)(F)F |
| InChI | InChI=1S/C17H18F6N6O/c18-16(19,20)12(17(21,22)23)30-15-27-13(25-10-11-4-2-1-3-5-11)26-14(28-15)29-8-6-24-7-9-29/h1-5,12,24H,6-10H2,(H,25,26,27,28) |
| InChIKey | HXUHQJYFXJTCAV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |