C20H27FN4O3 — CID 111400141
2-(3-fluorophenyl)-N-[2-[[N-[3-(furan-2-ylmethoxy)propyl]-N'-methylcarbamimidoyl]amino]ethyl]acetamide (PubChem CID 111400141) has the molecular formula C20H27FN4O3 and a molecular weight of 390.46 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-[2-[[N-[3-(furan-2-ylmethoxy)propyl]-N'-methylcarbamimidoyl]amino]ethyl]acetamide.
| Compound Name | 2-(3-fluorophenyl)-N-[2-[[N-[3-(furan-2-ylmethoxy)propyl]-N'-methylcarbamimidoyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 111400141 |
| Molecular Formula | C20H27FN4O3 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 2-(3-fluorophenyl)-N-[2-[[N-[3-(furan-2-ylmethoxy)propyl]-N'-methylcarbamimidoyl]amino]ethyl]acetamide |
| SMILES | C/N=C(\NCCCOCc1ccco1)NCCNC(=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C20H27FN4O3/c1-22-20(24-8-4-11-27-15-18-7-3-12-28-18)25-10-9-23-19(26)14-16-5-2-6-17(21)13-16/h2-3,5-7,12-13H,4,8-11,14-15H2,1H3,(H,23,26)(H2,22,24,25) |
| InChIKey | JBAGDUNLWMWGQI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|