C14H11N5O — CID 11140020
8-ethyl-5-oxo-7-phenyl-[1,2,4]triazolo[4,3-a]pyrimidine-6-carbonitrile (PubChem CID 11140020) has the molecular formula C14H11N5O and a molecular weight of 265.28 g/mol. Its IUPAC name is 8-ethyl-5-oxo-7-phenyl-[1,2,4]triazolo[4,3-a]pyrimidine-6-carbonitrile.
| Compound Name | 8-ethyl-5-oxo-7-phenyl-[1,2,4]triazolo[4,3-a]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 11140020 |
| Molecular Formula | C14H11N5O |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 8-ethyl-5-oxo-7-phenyl-[1,2,4]triazolo[4,3-a]pyrimidine-6-carbonitrile |
| SMILES | CCn1c(-c2ccccc2)c(C#N)c(=O)n2cnnc12 |
| InChI | InChI=1S/C14H11N5O/c1-2-18-12(10-6-4-3-5-7-10)11(8-15)13(20)19-9-16-17-14(18)19/h3-7,9H,2H2,1H3 |
| InChIKey | ZXYTWOVSZRBDSW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 75.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|