C20H34N4O2 — CID 111400927
N-benzyl-N-ethyl-2-[[N'-methyl-N-[3-(2-methylpropoxy)propyl]carbamimidoyl]amino]acetamide (PubChem CID 111400927) has the molecular formula C20H34N4O2 and a molecular weight of 362.52 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2-[[N'-methyl-N-[3-(2-methylpropoxy)propyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-benzyl-N-ethyl-2-[[N'-methyl-N-[3-(2-methylpropoxy)propyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111400927 |
| Molecular Formula | C20H34N4O2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | N-benzyl-N-ethyl-2-[[N'-methyl-N-[3-(2-methylpropoxy)propyl]carbamimidoyl]amino]acetamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CN/C(=N/C)NCCCOCC(C)C |
| InChI | InChI=1S/C20H34N4O2/c1-5-24(15-18-10-7-6-8-11-18)19(25)14-23-20(21-4)22-12-9-13-26-16-17(2)3/h6-8,10-11,17H,5,9,12-16H2,1-4H3,(H2,21,22,23) |
| InChIKey | YCABWHURGNCTNU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|