C19H31N3O — CID 111401199
2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-1-ethyl-3-[3-(2-methylpropoxy)propyl]guanidine (PubChem CID 111401199) has the molecular formula C19H31N3O and a molecular weight of 317.48 g/mol. Its IUPAC name is 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-1-ethyl-3-[3-(2-methylpropoxy)propyl]guanidine.
| Compound Name | 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-1-ethyl-3-[3-(2-methylpropoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111401199 |
| Molecular Formula | C19H31N3O |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-1-ethyl-3-[3-(2-methylpropoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CC1Cc2ccccc21)NCCCOCC(C)C |
| InChI | InChI=1S/C19H31N3O/c1-4-20-19(21-10-7-11-23-14-15(2)3)22-13-17-12-16-8-5-6-9-18(16)17/h5-6,8-9,15,17H,4,7,10-14H2,1-3H3,(H2,20,21,22) |
| InChIKey | DVBDWDXFGVQBIK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|