C13H22N2 — CID 1114020
2,2,6,6-tetramethyl-4-pyrrol-1-ylpiperidine (PubChem CID 1114020) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-pyrrol-1-ylpiperidine.
| Compound Name | 2,2,6,6-tetramethyl-4-pyrrol-1-ylpiperidine |
|---|---|
| PubChem CID | 1114020 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-pyrrol-1-ylpiperidine |
| SMILES | CC1(C)CC(n2cccc2)CC(C)(C)N1 |
| InChI | InChI=1S/C13H22N2/c1-12(2)9-11(10-13(3,4)14-12)15-7-5-6-8-15/h5-8,11,14H,9-10H2,1-4H3 |
| InChIKey | FLEQDAPZJCJHDU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |