C15H29IN4OS — CID 111402146
1-ethyl-3-[3-(2-methylpropoxy)propyl]-2-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111402146) has the molecular formula C15H29IN4OS and a molecular weight of 440.40 g/mol. Its IUPAC name is 1-ethyl-3-[3-(2-methylpropoxy)propyl]-2-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(2-methylpropoxy)propyl]-2-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111402146 |
| Molecular Formula | C15H29IN4OS |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 1-ethyl-3-[3-(2-methylpropoxy)propyl]-2-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1scnc1C)NCCCOCC(C)C.I |
| InChI | InChI=1S/C15H28N4OS.HI/c1-5-16-15(17-7-6-8-20-10-12(2)3)18-9-14-13(4)19-11-21-14;/h11-12H,5-10H2,1-4H3,(H2,16,17,18);1H |
| InChIKey | BYKZYZOBIXJYDG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|