C19H31IN4O2 — CID 111402642
1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-methyl-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide (PubChem CID 111402642) has the molecular formula C19H31IN4O2 and a molecular weight of 474.39 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-methyl-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-methyl-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111402642 |
| Molecular Formula | C19H31IN4O2 |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-methyl-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC(C)C)NCC(=O)N1CCc2ccccc21.I |
| InChI | InChI=1S/C19H30N4O2.HI/c1-15(2)14-25-12-6-10-21-19(20-3)22-13-18(24)23-11-9-16-7-4-5-8-17(16)23;/h4-5,7-8,15H,6,9-14H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | UQNVTPXCRJNOSI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|