C23H33N3O2 — CID 111402861
1-[2-(2-methoxyphenyl)propyl]-2-methyl-3-[3-(1-phenylethoxy)propyl]guanidine (PubChem CID 111402861) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenyl)propyl]-2-methyl-3-[3-(1-phenylethoxy)propyl]guanidine.
| Compound Name | 1-[2-(2-methoxyphenyl)propyl]-2-methyl-3-[3-(1-phenylethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111402861 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 1-[2-(2-methoxyphenyl)propyl]-2-methyl-3-[3-(1-phenylethoxy)propyl]guanidine |
| SMILES | C/N=C(\NCCCOC(C)c1ccccc1)NCC(C)c1ccccc1OC |
| InChI | InChI=1S/C23H33N3O2/c1-18(21-13-8-9-14-22(21)27-4)17-26-23(24-3)25-15-10-16-28-19(2)20-11-6-5-7-12-20/h5-9,11-14,18-19H,10,15-17H2,1-4H3,(H2,24,25,26) |
| InChIKey | HTXNDXALEFPVDR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|