C24H43N5O — CID 111403079
1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-[3-(1-phenylethoxy)propyl]guanidine (PubChem CID 111403079) has the molecular formula C24H43N5O and a molecular weight of 417.64 g/mol. Its IUPAC name is 1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-[3-(1-phenylethoxy)propyl]guanidine.
| Compound Name | 1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-[3-(1-phenylethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111403079 |
| Molecular Formula | C24H43N5O |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.35 |
| IUPAC Name | 1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-[3-(1-phenylethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CCCOC(C)c1ccccc1)NCCCCN1CCN(CC)CC1 |
| InChI | InChI=1S/C24H43N5O/c1-4-25-24(26-14-9-10-16-29-19-17-28(5-2)18-20-29)27-15-11-21-30-22(3)23-12-7-6-8-13-23/h6-8,12-13,22H,4-5,9-11,14-21H2,1-3H3,(H2,25,26,27) |
| InChIKey | JMJVSMXGCRYKAF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|