C25H36N4O2 — CID 111403353
N-tert-butyl-3-[[[N'-methyl-N-[3-(1-phenylethoxy)propyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111403353) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-tert-butyl-3-[[[N'-methyl-N-[3-(1-phenylethoxy)propyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-tert-butyl-3-[[[N'-methyl-N-[3-(1-phenylethoxy)propyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111403353 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | N-tert-butyl-3-[[[N'-methyl-N-[3-(1-phenylethoxy)propyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(\NCCCOC(C)c1ccccc1)NCc1cccc(C(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C25H36N4O2/c1-19(21-12-7-6-8-13-21)31-16-10-15-27-24(26-5)28-18-20-11-9-14-22(17-20)23(30)29-25(2,3)4/h6-9,11-14,17,19H,10,15-16,18H2,1-5H3,(H,29,30)(H2,26,27,28) |
| InChIKey | VZXXTTXSOCFAFZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|