About [(3Z)-3,9-dimethyl-6-prop-1-en-2-yldeca-3,9-dienyl] propanoate
[(3Z)-3,9-dimethyl-6-prop-1-en-2-yldeca-3,9-dienyl] propanoate (PubChem CID 11140436) has the molecular formula C18H30O2
and a molecular weight of 278.44 g/mol. Its IUPAC name is [(3Z)-3,9-dimethyl-6-prop-1-en-2-yldeca-3,9-dienyl] propanoate.
Molecular Properties
| Compound Name | [(3Z)-3,9-dimethyl-6-prop-1-en-2-yldeca-3,9-dienyl] propanoate |
| PubChem CID | 11140436 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | [(3Z)-3,9-dimethyl-6-prop-1-en-2-yldeca-3,9-dienyl] propanoate |
| SMILES | C=C(C)CCC(C/C=C(/C)CCOC(=O)CC)C(=C)C |
| InChI | InChI=1S/C18H30O2/c1-7-18(19)20-13-12-16(6)9-11-17(15(4)5)10-8-14(2)3/h9,17H,2,4,7-8,10-13H2,1,3,5-6H3/b16-9- |
| InChIKey | UYBNRMWMKVBBTM-SXGWCWSVSA-N |
| XLogP | 5.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-3,9-dimethyl-6-prop-1-en-2-yldeca-3,9-dienyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-3,9-dimethyl-6-prop-1-en-2-yldeca-3,9-dienyl] propanoate?
The IUPAC name of [(3Z)-3,9-dimethyl-6-prop-1-en-2-yldeca-3,9-dienyl] propanoate (CID 11140436) is [(3Z)-3,9-dimethyl-6-prop-1-en-2-yldeca-3,9-dienyl] propanoate.
What is the SMILES notation for [(3Z)-3,9-dimethyl-6-prop-1-en-2-yldeca-3,9-dienyl] propanoate?
The canonical SMILES for [(3Z)-3,9-dimethyl-6-prop-1-en-2-yldeca-3,9-dienyl] propanoate is C=C(C)CCC(C/C=C(/C)CCOC(=O)CC)C(=C)C.
What is the InChIKey of [(3Z)-3,9-dimethyl-6-prop-1-en-2-yldeca-3,9-dienyl] propanoate?
The InChIKey is UYBNRMWMKVBBTM-SXGWCWSVSA-N. The full InChI is InChI=1S/C18H30O2/c1-7-18(19)20-13-12-16(6)9-11-17(15(4)5)10-8-14(2)3/h9,17H,2,4,7-8,10-13H2,1,3,5-6H3/b16-9-.
What are the key properties of [(3Z)-3,9-dimethyl-6-prop-1-en-2-yldeca-3,9-dienyl] propanoate?
[(3Z)-3,9-dimethyl-6-prop-1-en-2-yldeca-3,9-dienyl] propanoate has a molecular weight of 278.44 g/mol, XLogP of 5.21, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-3,9-dimethyl-6-prop-1-en-2-yldeca-3,9-dienyl] propanoate is sourced from PubChem (CID 11140436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).