C17H35IN4O3 — CID 111404802
1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[3-(3-methylpiperidin-1-yl)-3-oxopropyl]guanidine;hydroiodide (PubChem CID 111404802) has the molecular formula C17H35IN4O3 and a molecular weight of 470.40 g/mol. Its IUPAC name is 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[3-(3-methylpiperidin-1-yl)-3-oxopropyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[3-(3-methylpiperidin-1-yl)-3-oxopropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111404802 |
| Molecular Formula | C17H35IN4O3 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[3-(3-methylpiperidin-1-yl)-3-oxopropyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCCOC)NCCC(=O)N1CCCC(C)C1.I |
| InChI | InChI=1S/C17H34N4O3.HI/c1-15-6-4-10-21(14-15)16(22)7-9-20-17(18-2)19-8-5-11-24-13-12-23-3;/h15H,4-14H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | KARANVRGCUFPHI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|