About 2-methyl-5-(4-methylsulfanylphenyl)-4-phenyl-3H-1,2-oxazole
2-methyl-5-(4-methylsulfanylphenyl)-4-phenyl-3H-1,2-oxazole (PubChem CID 11140598) has the molecular formula C17H17NOS
and a molecular weight of 283.40 g/mol. Its IUPAC name is 2-methyl-5-(4-methylsulfanylphenyl)-4-phenyl-3H-1,2-oxazole.
Molecular Properties
| Compound Name | 2-methyl-5-(4-methylsulfanylphenyl)-4-phenyl-3H-1,2-oxazole |
| PubChem CID | 11140598 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-methyl-5-(4-methylsulfanylphenyl)-4-phenyl-3H-1,2-oxazole |
| SMILES | CSc1ccc(C2=C(c3ccccc3)CN(C)O2)cc1 |
| InChI | InChI=1S/C17H17NOS/c1-18-12-16(13-6-4-3-5-7-13)17(19-18)14-8-10-15(20-2)11-9-14/h3-11H,12H2,1-2H3 |
| InChIKey | UFKINCCQLHMPNJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-(4-methylsulfanylphenyl)-4-phenyl-3H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-(4-methylsulfanylphenyl)-4-phenyl-3H-1,2-oxazole?
The IUPAC name of 2-methyl-5-(4-methylsulfanylphenyl)-4-phenyl-3H-1,2-oxazole (CID 11140598) is 2-methyl-5-(4-methylsulfanylphenyl)-4-phenyl-3H-1,2-oxazole.
What is the SMILES notation for 2-methyl-5-(4-methylsulfanylphenyl)-4-phenyl-3H-1,2-oxazole?
The canonical SMILES for 2-methyl-5-(4-methylsulfanylphenyl)-4-phenyl-3H-1,2-oxazole is CSc1ccc(C2=C(c3ccccc3)CN(C)O2)cc1.
What is the InChIKey of 2-methyl-5-(4-methylsulfanylphenyl)-4-phenyl-3H-1,2-oxazole?
The InChIKey is UFKINCCQLHMPNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NOS/c1-18-12-16(13-6-4-3-5-7-13)17(19-18)14-8-10-15(20-2)11-9-14/h3-11H,12H2,1-2H3.
What are the key properties of 2-methyl-5-(4-methylsulfanylphenyl)-4-phenyl-3H-1,2-oxazole?
2-methyl-5-(4-methylsulfanylphenyl)-4-phenyl-3H-1,2-oxazole has a molecular weight of 283.40 g/mol, XLogP of 4.15, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-(4-methylsulfanylphenyl)-4-phenyl-3H-1,2-oxazole is sourced from PubChem (CID 11140598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).