C14H20O6 — CID 11140620
ethyl 2-[(4aS,6R,8R,8aR)-6-ethoxy-2-oxo-6,7,8,8a-tetrahydro-4aH-pyrano[3,2-b]pyran-8-yl]acetate (PubChem CID 11140620) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is ethyl 2-[(4aS,6R,8R,8aR)-6-ethoxy-2-oxo-6,7,8,8a-tetrahydro-4aH-pyrano[3,2-b]pyran-8-yl]acetate.
| Compound Name | ethyl 2-[(4aS,6R,8R,8aR)-6-ethoxy-2-oxo-6,7,8,8a-tetrahydro-4aH-pyrano[3,2-b]pyran-8-yl]acetate |
|---|---|
| PubChem CID | 11140620 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | ethyl 2-[(4aS,6R,8R,8aR)-6-ethoxy-2-oxo-6,7,8,8a-tetrahydro-4aH-pyrano[3,2-b]pyran-8-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C[C@H](OCC)O[C@H]2C=CC(=O)O[C@H]12 |
| InChI | InChI=1S/C14H20O6/c1-3-17-12(16)7-9-8-13(18-4-2)19-10-5-6-11(15)20-14(9)10/h5-6,9-10,13-14H,3-4,7-8H2,1-2H3/t9-,10-,13+,14+/m0/s1 |
| InChIKey | SFFPPSKFXQPNFZ-DUBDDPSESA-N |
| XLogP | 1.19 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |