About [(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate
[(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 11140627) has the molecular formula C13H16O5S
and a molecular weight of 284.33 g/mol. Its IUPAC name is [(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate |
| PubChem CID | 11140627 |
| Molecular Formula | C13H16O5S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | [(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2OC(=O)C[C@@H]2C)cc1 |
| InChI | InChI=1S/C13H16O5S/c1-9-3-5-11(6-4-9)19(15,16)17-8-12-10(2)7-13(14)18-12/h3-6,10,12H,7-8H2,1-2H3/t10-,12+/m0/s1 |
| InChIKey | JYJJUYNIULSWPR-CMPLNLGQSA-N |
| XLogP | 1.65 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate?
The IUPAC name of [(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate (CID 11140627) is [(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate.
What is the SMILES notation for [(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate?
The canonical SMILES for [(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OC[C@H]2OC(=O)C[C@@H]2C)cc1.
What is the InChIKey of [(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate?
The InChIKey is JYJJUYNIULSWPR-CMPLNLGQSA-N. The full InChI is InChI=1S/C13H16O5S/c1-9-3-5-11(6-4-9)19(15,16)17-8-12-10(2)7-13(14)18-12/h3-6,10,12H,7-8H2,1-2H3/t10-,12+/m0/s1.
What are the key properties of [(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate?
[(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate has a molecular weight of 284.33 g/mol, XLogP of 1.65, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-3-methyl-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 11140627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).