C16H34O2Si — CID 11140710
(4S,6S)-2,2,4-tritert-butyl-6-methyl-1,3,2-dioxasilinane (PubChem CID 11140710) has the molecular formula C16H34O2Si and a molecular weight of 286.53 g/mol. Its IUPAC name is (4S,6S)-2,2,4-tritert-butyl-6-methyl-1,3,2-dioxasilinane.
| Compound Name | (4S,6S)-2,2,4-tritert-butyl-6-methyl-1,3,2-dioxasilinane |
|---|---|
| PubChem CID | 11140710 |
| Molecular Formula | C16H34O2Si |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (4S,6S)-2,2,4-tritert-butyl-6-methyl-1,3,2-dioxasilinane |
| SMILES | C[C@H]1C[C@@H](C(C)(C)C)O[Si](C(C)(C)C)(C(C)(C)C)O1 |
| InChI | InChI=1S/C16H34O2Si/c1-12-11-13(14(2,3)4)18-19(17-12,15(5,6)7)16(8,9)10/h12-13H,11H2,1-10H3/t12-,13-/m0/s1 |
| InChIKey | NVFDHWPHEPQHEO-STQMWFEESA-N |
| XLogP | 5.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|