C18H28FIN4O3 — CID 111407882
N-(4-fluorophenyl)-2-[[N'-methyl-N-[3-(oxolan-2-ylmethoxy)propyl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111407882) has the molecular formula C18H28FIN4O3 and a molecular weight of 494.35 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[N'-methyl-N-[3-(oxolan-2-ylmethoxy)propyl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-(4-fluorophenyl)-2-[[N'-methyl-N-[3-(oxolan-2-ylmethoxy)propyl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111407882 |
| Molecular Formula | C18H28FIN4O3 |
| Molecular Weight | 494.35 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[N'-methyl-N-[3-(oxolan-2-ylmethoxy)propyl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CCCO1)NCC(=O)Nc1ccc(F)cc1.I |
| InChI | InChI=1S/C18H27FN4O3.HI/c1-20-18(21-9-3-10-25-13-16-4-2-11-26-16)22-12-17(24)23-15-7-5-14(19)6-8-15;/h5-8,16H,2-4,9-13H2,1H3,(H,23,24)(H2,20,21,22);1H |
| InChIKey | APWLTGFLERXURJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|