C21H35N3O5 — CID 111408743
1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine (PubChem CID 111408743) has the molecular formula C21H35N3O5 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111408743 |
| Molecular Formula | C21H35N3O5 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | 1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]-2-[(2,3,4-trimethoxyphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1OC)NCCCOCC1CCCO1 |
| InChI | InChI=1S/C21H35N3O5/c1-5-22-21(23-11-7-12-28-15-17-8-6-13-29-17)24-14-16-9-10-18(25-2)20(27-4)19(16)26-3/h9-10,17H,5-8,11-15H2,1-4H3,(H2,22,23,24) |
| InChIKey | MSFBWJOBBABYBU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|