C25H41N3O4 — CID 111408913
2-[[4-(4-ethoxyphenyl)oxan-4-yl]methyl]-1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine (PubChem CID 111408913) has the molecular formula C25H41N3O4 and a molecular weight of 447.62 g/mol. Its IUPAC name is 2-[[4-(4-ethoxyphenyl)oxan-4-yl]methyl]-1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine.
| Compound Name | 2-[[4-(4-ethoxyphenyl)oxan-4-yl]methyl]-1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111408913 |
| Molecular Formula | C25H41N3O4 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | 2-[[4-(4-ethoxyphenyl)oxan-4-yl]methyl]-1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CC1(c2ccc(OCC)cc2)CCOCC1)NCCCOCC1CCCO1 |
| InChI | InChI=1S/C25H41N3O4/c1-3-26-24(27-14-6-15-30-19-23-7-5-16-32-23)28-20-25(12-17-29-18-13-25)21-8-10-22(11-9-21)31-4-2/h8-11,23H,3-7,12-20H2,1-2H3,(H2,26,27,28) |
| InChIKey | SBKHDCBAHZNNCN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|