C17H28O2Si — CID 11140893
ethyl 5-propan-2-ylidene-6-trimethylsilyl-1,2,3,4-tetrahydropentalene-3a-carboxylate (PubChem CID 11140893) has the molecular formula C17H28O2Si and a molecular weight of 292.50 g/mol. Its IUPAC name is ethyl 5-propan-2-ylidene-6-trimethylsilyl-1,2,3,4-tetrahydropentalene-3a-carboxylate.
| Compound Name | ethyl 5-propan-2-ylidene-6-trimethylsilyl-1,2,3,4-tetrahydropentalene-3a-carboxylate |
|---|---|
| PubChem CID | 11140893 |
| Molecular Formula | C17H28O2Si |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | ethyl 5-propan-2-ylidene-6-trimethylsilyl-1,2,3,4-tetrahydropentalene-3a-carboxylate |
| SMILES | CCOC(=O)C12CCCC1=C([Si](C)(C)C)C(=C(C)C)C2 |
| InChI | InChI=1S/C17H28O2Si/c1-7-19-16(18)17-10-8-9-14(17)15(20(4,5)6)13(11-17)12(2)3/h7-11H2,1-6H3 |
| InChIKey | AWLRAJCHOSDNQW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|