About 1-methoxy-4-[(1E,5E)-6-(4-methoxyphenyl)hexa-1,5-dienyl]benzene
1-methoxy-4-[(1E,5E)-6-(4-methoxyphenyl)hexa-1,5-dienyl]benzene (PubChem CID 11140953) has the molecular formula C20H22O2
and a molecular weight of 294.39 g/mol. Its IUPAC name is 1-methoxy-4-[(1E,5E)-6-(4-methoxyphenyl)hexa-1,5-dienyl]benzene.
Molecular Properties
| Compound Name | 1-methoxy-4-[(1E,5E)-6-(4-methoxyphenyl)hexa-1,5-dienyl]benzene |
| PubChem CID | 11140953 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1-methoxy-4-[(1E,5E)-6-(4-methoxyphenyl)hexa-1,5-dienyl]benzene |
| SMILES | COc1ccc(/C=C/CC/C=C/c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H22O2/c1-21-19-13-9-17(10-14-19)7-5-3-4-6-8-18-11-15-20(22-2)16-12-18/h5-16H,3-4H2,1-2H3/b7-5+,8-6+ |
| InChIKey | FWOYMKXDIXNXIC-KQQUZDAGSA-N |
| XLogP | 5.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-4-[(1E,5E)-6-(4-methoxyphenyl)hexa-1,5-dienyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-4-[(1E,5E)-6-(4-methoxyphenyl)hexa-1,5-dienyl]benzene?
The IUPAC name of 1-methoxy-4-[(1E,5E)-6-(4-methoxyphenyl)hexa-1,5-dienyl]benzene (CID 11140953) is 1-methoxy-4-[(1E,5E)-6-(4-methoxyphenyl)hexa-1,5-dienyl]benzene.
What is the SMILES notation for 1-methoxy-4-[(1E,5E)-6-(4-methoxyphenyl)hexa-1,5-dienyl]benzene?
The canonical SMILES for 1-methoxy-4-[(1E,5E)-6-(4-methoxyphenyl)hexa-1,5-dienyl]benzene is COc1ccc(/C=C/CC/C=C/c2ccc(OC)cc2)cc1.
What is the InChIKey of 1-methoxy-4-[(1E,5E)-6-(4-methoxyphenyl)hexa-1,5-dienyl]benzene?
The InChIKey is FWOYMKXDIXNXIC-KQQUZDAGSA-N. The full InChI is InChI=1S/C20H22O2/c1-21-19-13-9-17(10-14-19)7-5-3-4-6-8-18-11-15-20(22-2)16-12-18/h5-16H,3-4H2,1-2H3/b7-5+,8-6+.
What are the key properties of 1-methoxy-4-[(1E,5E)-6-(4-methoxyphenyl)hexa-1,5-dienyl]benzene?
1-methoxy-4-[(1E,5E)-6-(4-methoxyphenyl)hexa-1,5-dienyl]benzene has a molecular weight of 294.39 g/mol, XLogP of 5.21, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-4-[(1E,5E)-6-(4-methoxyphenyl)hexa-1,5-dienyl]benzene is sourced from PubChem (CID 11140953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).