C21H34N4O4S — CID 111409845
1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-3-ethyl-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine (PubChem CID 111409845) has the molecular formula C21H34N4O4S and a molecular weight of 438.59 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-3-ethyl-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine.
| Compound Name | 1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-3-ethyl-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111409845 |
| Molecular Formula | C21H34N4O4S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-3-ethyl-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CCCOCC1CCCO1)NCCS(=O)(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C21H34N4O4S/c1-2-22-21(23-11-6-14-28-17-19-8-5-15-29-19)24-12-16-30(26,27)25-13-10-18-7-3-4-9-20(18)25/h3-4,7,9,19H,2,5-6,8,10-17H2,1H3,(H2,22,23,24) |
| InChIKey | WZDSCEYDGRVDHV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|