About (E,1S)-N-benzyl-1,3-diphenylprop-2-en-1-amine
(E,1S)-N-benzyl-1,3-diphenylprop-2-en-1-amine (PubChem CID 11141090) has the molecular formula C22H21N
and a molecular weight of 299.42 g/mol. Its IUPAC name is (E,1S)-N-benzyl-1,3-diphenylprop-2-en-1-amine.
Molecular Properties
| Compound Name | (E,1S)-N-benzyl-1,3-diphenylprop-2-en-1-amine |
| PubChem CID | 11141090 |
| Molecular Formula | C22H21N |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (E,1S)-N-benzyl-1,3-diphenylprop-2-en-1-amine |
| SMILES | C(=C/[C@H](NCc1ccccc1)c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C22H21N/c1-4-10-19(11-5-1)16-17-22(21-14-8-3-9-15-21)23-18-20-12-6-2-7-13-20/h1-17,22-23H,18H2/b17-16+/t22-/m0/s1 |
| InChIKey | DHXOANBSQFONCB-QWYDYZLZSA-N |
| XLogP | 5.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E,1S)-N-benzyl-1,3-diphenylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,1S)-N-benzyl-1,3-diphenylprop-2-en-1-amine?
The IUPAC name of (E,1S)-N-benzyl-1,3-diphenylprop-2-en-1-amine (CID 11141090) is (E,1S)-N-benzyl-1,3-diphenylprop-2-en-1-amine.
What is the SMILES notation for (E,1S)-N-benzyl-1,3-diphenylprop-2-en-1-amine?
The canonical SMILES for (E,1S)-N-benzyl-1,3-diphenylprop-2-en-1-amine is C(=C/[C@H](NCc1ccccc1)c1ccccc1)\c1ccccc1.
What is the InChIKey of (E,1S)-N-benzyl-1,3-diphenylprop-2-en-1-amine?
The InChIKey is DHXOANBSQFONCB-QWYDYZLZSA-N. The full InChI is InChI=1S/C22H21N/c1-4-10-19(11-5-1)16-17-22(21-14-8-3-9-15-21)23-18-20-12-6-2-7-13-20/h1-17,22-23H,18H2/b17-16+/t22-/m0/s1.
What are the key properties of (E,1S)-N-benzyl-1,3-diphenylprop-2-en-1-amine?
(E,1S)-N-benzyl-1,3-diphenylprop-2-en-1-amine has a molecular weight of 299.42 g/mol, XLogP of 5.23, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E,1S)-N-benzyl-1,3-diphenylprop-2-en-1-amine is sourced from PubChem (CID 11141090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).