C26H38IN5O — CID 111411580
2-methyl-1-[(2-morpholin-4-ylphenyl)methyl]-3-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111411580) has the molecular formula C26H38IN5O and a molecular weight of 563.53 g/mol. Its IUPAC name is 2-methyl-1-[(2-morpholin-4-ylphenyl)methyl]-3-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(2-morpholin-4-ylphenyl)methyl]-3-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111411580 |
| Molecular Formula | C26H38IN5O |
| Molecular Weight | 563.53 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | 2-methyl-1-[(2-morpholin-4-ylphenyl)methyl]-3-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(CN2CCCCC2)cc1)NCc1ccccc1N1CCOCC1.I |
| InChI | InChI=1S/C26H37N5O.HI/c1-27-26(29-20-24-7-3-4-8-25(24)31-15-17-32-18-16-31)28-19-22-9-11-23(12-10-22)21-30-13-5-2-6-14-30;/h3-4,7-12H,2,5-6,13-21H2,1H3,(H2,27,28,29);1H |
| InChIKey | SLMCUKNRPUUQMI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|