About 3-(bromomethyl)pyrido[3,2-g]quinoline-5,10-dione
3-(bromomethyl)pyrido[3,2-g]quinoline-5,10-dione (PubChem CID 11141199) has the molecular formula C13H7BrN2O2
and a molecular weight of 303.12 g/mol. Its IUPAC name is 3-(bromomethyl)pyrido[3,2-g]quinoline-5,10-dione.
Molecular Properties
| Compound Name | 3-(bromomethyl)pyrido[3,2-g]quinoline-5,10-dione |
| PubChem CID | 11141199 |
| Molecular Formula | C13H7BrN2O2 |
| Molecular Weight | 303.12 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | 3-(bromomethyl)pyrido[3,2-g]quinoline-5,10-dione |
| SMILES | O=C1c2cccnc2C(=O)c2ncc(CBr)cc21 |
| InChI | InChI=1S/C13H7BrN2O2/c14-5-7-4-9-11(16-6-7)13(18)10-8(12(9)17)2-1-3-15-10/h1-4,6H,5H2 |
| InChIKey | BURDIDMYOSZEKU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.12 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(bromomethyl)pyrido[3,2-g]quinoline-5,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(bromomethyl)pyrido[3,2-g]quinoline-5,10-dione?
The IUPAC name of 3-(bromomethyl)pyrido[3,2-g]quinoline-5,10-dione (CID 11141199) is 3-(bromomethyl)pyrido[3,2-g]quinoline-5,10-dione.
What is the SMILES notation for 3-(bromomethyl)pyrido[3,2-g]quinoline-5,10-dione?
The canonical SMILES for 3-(bromomethyl)pyrido[3,2-g]quinoline-5,10-dione is O=C1c2cccnc2C(=O)c2ncc(CBr)cc21.
What is the InChIKey of 3-(bromomethyl)pyrido[3,2-g]quinoline-5,10-dione?
The InChIKey is BURDIDMYOSZEKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7BrN2O2/c14-5-7-4-9-11(16-6-7)13(18)10-8(12(9)17)2-1-3-15-10/h1-4,6H,5H2.
What are the key properties of 3-(bromomethyl)pyrido[3,2-g]quinoline-5,10-dione?
3-(bromomethyl)pyrido[3,2-g]quinoline-5,10-dione has a molecular weight of 303.12 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(bromomethyl)pyrido[3,2-g]quinoline-5,10-dione is sourced from PubChem (CID 11141199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).