C12H18ClNO2SSi — CID 11141225
(NE)-N-[(4-chlorophenyl)methylidene]-2-trimethylsilylethanesulfonamide (PubChem CID 11141225) has the molecular formula C12H18ClNO2SSi and a molecular weight of 303.89 g/mol. Its IUPAC name is (NE)-N-[(4-chlorophenyl)methylidene]-2-trimethylsilylethanesulfonamide.
| Compound Name | (NE)-N-[(4-chlorophenyl)methylidene]-2-trimethylsilylethanesulfonamide |
|---|---|
| PubChem CID | 11141225 |
| Molecular Formula | C12H18ClNO2SSi |
| Molecular Weight | 303.89 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | (NE)-N-[(4-chlorophenyl)methylidene]-2-trimethylsilylethanesulfonamide |
| SMILES | C[Si](C)(C)CCS(=O)(=O)/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H18ClNO2SSi/c1-18(2,3)9-8-17(15,16)14-10-11-4-6-12(13)7-5-11/h4-7,10H,8-9H2,1-3H3/b14-10+ |
| InChIKey | AHLGMSRDDCMAFU-GXDHUFHOSA-N |
| XLogP | 3.43 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.89 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|