C20H24IN5O3 — CID 111413209
2-methyl-1-[(4-nitrophenyl)methyl]-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111413209) has the molecular formula C20H24IN5O3 and a molecular weight of 509.35 g/mol. Its IUPAC name is 2-methyl-1-[(4-nitrophenyl)methyl]-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(4-nitrophenyl)methyl]-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111413209 |
| Molecular Formula | C20H24IN5O3 |
| Molecular Weight | 509.35 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 2-methyl-1-[(4-nitrophenyl)methyl]-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(N2CCCC2=O)cc1)NCc1ccc([N+](=O)[O-])cc1.I |
| InChI | InChI=1S/C20H23N5O3.HI/c1-21-20(23-14-16-6-10-18(11-7-16)25(27)28)22-13-15-4-8-17(9-5-15)24-12-2-3-19(24)26;/h4-11H,2-3,12-14H2,1H3,(H2,21,22,23);1H |
| InChIKey | VZZLJVAMQBZOBR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|