C23H30IN5O2S — CID 111414077
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-ethyl-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111414077) has the molecular formula C23H30IN5O2S and a molecular weight of 567.50 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-ethyl-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-ethyl-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111414077 |
| Molecular Formula | C23H30IN5O2S |
| Molecular Weight | 567.50 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-ethyl-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCCC2=O)cc1)NCC(=O)N1CCc2sccc2C1.I |
| InChI | InChI=1S/C23H29N5O2S.HI/c1-2-24-23(26-15-22(30)27-12-9-20-18(16-27)10-13-31-20)25-14-17-5-7-19(8-6-17)28-11-3-4-21(28)29;/h5-8,10,13H,2-4,9,11-12,14-16H2,1H3,(H2,24,25,26);1H |
| InChIKey | BELPRIXBVVBHSI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|