C12H19NO6 — CID 11141413
(1R,2R,3R,6S)-6-[[(1S,4R,5R,6R)-4,5,6-trihydroxycyclohex-2-en-1-yl]amino]cyclohex-4-ene-1,2,3-triol (PubChem CID 11141413) has the molecular formula C12H19NO6 and a molecular weight of 273.29 g/mol. Its IUPAC name is (1R,2R,3R,6S)-6-[[(1S,4R,5R,6R)-4,5,6-trihydroxycyclohex-2-en-1-yl]amino]cyclohex-4-ene-1,2,3-triol.
| Compound Name | (1R,2R,3R,6S)-6-[[(1S,4R,5R,6R)-4,5,6-trihydroxycyclohex-2-en-1-yl]amino]cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 11141413 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (1R,2R,3R,6S)-6-[[(1S,4R,5R,6R)-4,5,6-trihydroxycyclohex-2-en-1-yl]amino]cyclohex-4-ene-1,2,3-triol |
| SMILES | O[C@H]1[C@H](O)[C@@H](N[C@H]2C=C[C@@H](O)[C@@H](O)[C@@H]2O)C=C[C@H]1O |
| InChI | InChI=1S/C12H19NO6/c14-7-3-1-5(9(16)11(7)18)13-6-2-4-8(15)12(19)10(6)17/h1-19H/t5-,6-,7+,8+,9+,10+,11+,12+/m0/s1 |
| InChIKey | QOHFSVSHWJBXNC-JLFWRBHBSA-N |
| XLogP | -3.38 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|